C24H38N3O9S+ — CID 169316356
2-[(E)-4-[[(15R)-16,16-dimethyl-2,5,10,14-tetraoxo-1-oxa-6-thia-9,13-diazacycloheptadec-15-yl]oxy]-4-oxobut-2-enoyl]oxyethyl-trimethylazanium (PubChem CID 169316356) has the molecular formula C24H38N3O9S+ and a molecular weight of 544.65 g/mol. Its IUPAC name is 2-[(E)-4-[[(15R)-16,16-dimethyl-2,5,10,14-tetraoxo-1-oxa-6-thia-9,13-diazacycloheptadec-15-yl]oxy]-4-oxobut-2-enoyl]oxyethyl-trimethylazanium.
| Compound Name | 2-[(E)-4-[[(15R)-16,16-dimethyl-2,5,10,14-tetraoxo-1-oxa-6-thia-9,13-diazacycloheptadec-15-yl]oxy]-4-oxobut-2-enoyl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 169316356 |
| Molecular Formula | C24H38N3O9S+ |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | 2-[(E)-4-[[(15R)-16,16-dimethyl-2,5,10,14-tetraoxo-1-oxa-6-thia-9,13-diazacycloheptadec-15-yl]oxy]-4-oxobut-2-enoyl]oxyethyl-trimethylazanium |
| SMILES | CC1(C)COC(=O)CCC(=O)SCCNC(=O)CCNC(=O)[C@@H]1OC(=O)/C=C/C(=O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C24H37N3O9S/c1-24(2)16-35-19(30)8-9-21(32)37-15-12-25-17(28)10-11-26-23(33)22(24)36-20(31)7-6-18(29)34-14-13-27(3,4)5/h6-7,22H,8-16H2,1-5H3,(H-,25,26,28,33)/p+1/b7-6+/t22-/m0/s1 |
| InChIKey | OEQHTEOTDLKEFK-WMWRJIBUSA-O |
| XLogP | -0.05 |
| TPSA | 154.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|