C21H34N3O8S+ — CID 169316363
2-[[(3E,15R)-16,16-dimethyl-2,5,10,14-tetraoxo-1-oxa-6-thia-9,13-diazacycloheptadec-3-en-15-yl]oxycarbonyloxy]ethyl-trimethylazanium (PubChem CID 169316363) has the molecular formula C21H34N3O8S+ and a molecular weight of 488.58 g/mol. Its IUPAC name is 2-[[(3E,15R)-16,16-dimethyl-2,5,10,14-tetraoxo-1-oxa-6-thia-9,13-diazacycloheptadec-3-en-15-yl]oxycarbonyloxy]ethyl-trimethylazanium.
| Compound Name | 2-[[(3E,15R)-16,16-dimethyl-2,5,10,14-tetraoxo-1-oxa-6-thia-9,13-diazacycloheptadec-3-en-15-yl]oxycarbonyloxy]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 169316363 |
| Molecular Formula | C21H34N3O8S+ |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 2-[[(3E,15R)-16,16-dimethyl-2,5,10,14-tetraoxo-1-oxa-6-thia-9,13-diazacycloheptadec-3-en-15-yl]oxycarbonyloxy]ethyl-trimethylazanium |
| SMILES | CC1(C)COC(=O)/C=C/C(=O)SCCNC(=O)CCNC(=O)[C@@H]1OC(=O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C21H33N3O8S/c1-21(2)14-31-16(26)6-7-17(27)33-13-10-22-15(25)8-9-23-19(28)18(21)32-20(29)30-12-11-24(3,4)5/h6-7,18H,8-14H2,1-5H3,(H-,22,23,25,28)/p+1/b7-6+/t18-/m0/s1 |
| InChIKey | XSVUIIIUSXNMRT-DKFQHHCZSA-O |
| XLogP | 0.24 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|