C16H21NO5 — CID 169317814
2-methoxyethyl 2-[(3aR,6aS)-4,6-bis(ethenyl)-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl]acetate (PubChem CID 169317814) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-methoxyethyl 2-[(3aR,6aS)-4,6-bis(ethenyl)-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl]acetate.
| Compound Name | 2-methoxyethyl 2-[(3aR,6aS)-4,6-bis(ethenyl)-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl]acetate |
|---|---|
| PubChem CID | 169317814 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-methoxyethyl 2-[(3aR,6aS)-4,6-bis(ethenyl)-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl]acetate |
| SMILES | C=CC1CC(C=C)[C@@H]2C(=O)N(CC(=O)OCCOC)C(=O)[C@H]12 |
| InChI | InChI=1S/C16H21NO5/c1-4-10-8-11(5-2)14-13(10)15(19)17(16(14)20)9-12(18)22-7-6-21-3/h4-5,10-11,13-14H,1-2,6-9H2,3H3/t10?,11?,13-,14+ |
| InChIKey | YTXCSJAHDJRYCA-QCBYLEPLSA-N |
| XLogP | 0.79 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|