About 1-(4-acetyl-1-thia-4,8-diazaspiro[4.5]decan-8-yl)-2,2-dimethylpropan-1-one
1-(4-acetyl-1-thia-4,8-diazaspiro[4.5]decan-8-yl)-2,2-dimethylpropan-1-one (PubChem CID 169318639) has the molecular formula C14H24N2O2S
and a molecular weight of 284.42 g/mol. Its IUPAC name is 1-(4-acetyl-1-thia-4,8-diazaspiro[4.5]decan-8-yl)-2,2-dimethylpropan-1-one.
Molecular Properties
| Compound Name | 1-(4-acetyl-1-thia-4,8-diazaspiro[4.5]decan-8-yl)-2,2-dimethylpropan-1-one |
| PubChem CID | 169318639 |
| Molecular Formula | C14H24N2O2S |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 1-(4-acetyl-1-thia-4,8-diazaspiro[4.5]decan-8-yl)-2,2-dimethylpropan-1-one |
| SMILES | CC(=O)N1CCSC12CCN(C(=O)C(C)(C)C)CC2 |
| InChI | InChI=1S/C14H24N2O2S/c1-11(17)16-9-10-19-14(16)5-7-15(8-6-14)12(18)13(2,3)4/h5-10H2,1-4H3 |
| InChIKey | IRCIHPOHDOZMMR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-acetyl-1-thia-4,8-diazaspiro[4.5]decan-8-yl)-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-acetyl-1-thia-4,8-diazaspiro[4.5]decan-8-yl)-2,2-dimethylpropan-1-one?
The IUPAC name of 1-(4-acetyl-1-thia-4,8-diazaspiro[4.5]decan-8-yl)-2,2-dimethylpropan-1-one (CID 169318639) is 1-(4-acetyl-1-thia-4,8-diazaspiro[4.5]decan-8-yl)-2,2-dimethylpropan-1-one.
What is the SMILES notation for 1-(4-acetyl-1-thia-4,8-diazaspiro[4.5]decan-8-yl)-2,2-dimethylpropan-1-one?
The canonical SMILES for 1-(4-acetyl-1-thia-4,8-diazaspiro[4.5]decan-8-yl)-2,2-dimethylpropan-1-one is CC(=O)N1CCSC12CCN(C(=O)C(C)(C)C)CC2.
What is the InChIKey of 1-(4-acetyl-1-thia-4,8-diazaspiro[4.5]decan-8-yl)-2,2-dimethylpropan-1-one?
The InChIKey is IRCIHPOHDOZMMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O2S/c1-11(17)16-9-10-19-14(16)5-7-15(8-6-14)12(18)13(2,3)4/h5-10H2,1-4H3.
What are the key properties of 1-(4-acetyl-1-thia-4,8-diazaspiro[4.5]decan-8-yl)-2,2-dimethylpropan-1-one?
1-(4-acetyl-1-thia-4,8-diazaspiro[4.5]decan-8-yl)-2,2-dimethylpropan-1-one has a molecular weight of 284.42 g/mol, XLogP of 1.95, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-acetyl-1-thia-4,8-diazaspiro[4.5]decan-8-yl)-2,2-dimethylpropan-1-one is sourced from PubChem (CID 169318639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).