C15H30N4 — CID 169319806
1-methyl-4-[1-[(1-methylpiperidin-4-yl)methyl]azetidin-3-yl]piperazine (PubChem CID 169319806) has the molecular formula C15H30N4 and a molecular weight of 266.43 g/mol. Its IUPAC name is 1-methyl-4-[1-[(1-methylpiperidin-4-yl)methyl]azetidin-3-yl]piperazine.
| Compound Name | 1-methyl-4-[1-[(1-methylpiperidin-4-yl)methyl]azetidin-3-yl]piperazine |
|---|---|
| PubChem CID | 169319806 |
| Molecular Formula | C15H30N4 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.25 |
| IUPAC Name | 1-methyl-4-[1-[(1-methylpiperidin-4-yl)methyl]azetidin-3-yl]piperazine |
| SMILES | CN1CCC(CN2CC(N3CCN(C)CC3)C2)CC1 |
| InChI | InChI=1S/C15H30N4/c1-16-5-3-14(4-6-16)11-18-12-15(13-18)19-9-7-17(2)8-10-19/h14-15H,3-13H2,1-2H3 |
| InChIKey | CQXAEVFJEZUZPR-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |