About 2-[4-(dimethylamino)-2-methylbutanoyl]oxyundecyl 2-heptylundecanoate
2-[4-(dimethylamino)-2-methylbutanoyl]oxyundecyl 2-heptylundecanoate (PubChem CID 169320459) has the molecular formula C36H71NO4
and a molecular weight of 581.97 g/mol. Its IUPAC name is 2-[4-(dimethylamino)-2-methylbutanoyl]oxyundecyl 2-heptylundecanoate.
Molecular Properties
| Compound Name | 2-[4-(dimethylamino)-2-methylbutanoyl]oxyundecyl 2-heptylundecanoate |
| PubChem CID | 169320459 |
| Molecular Formula | C36H71NO4 |
| Molecular Weight | 581.97 g/mol |
| Exact Mass | 581.54 |
| IUPAC Name | 2-[4-(dimethylamino)-2-methylbutanoyl]oxyundecyl 2-heptylundecanoate |
| SMILES | CCCCCCCCCC(COC(=O)C(CCCCCCC)CCCCCCCCC)OC(=O)C(C)CCN(C)C |
| InChI | InChI=1S/C36H71NO4/c1-7-10-13-16-18-21-24-27-33(26-23-20-15-12-9-3)36(39)40-31-34(28-25-22-19-17-14-11-8-2)41-35(38)32(4)29-30-37(5)6/h32-34H,7-31H2,1-6H3 |
| InChIKey | BGEOTTNKZMHCBX-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 581.97 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(dimethylamino)-2-methylbutanoyl]oxyundecyl 2-heptylundecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(dimethylamino)-2-methylbutanoyl]oxyundecyl 2-heptylundecanoate?
The IUPAC name of 2-[4-(dimethylamino)-2-methylbutanoyl]oxyundecyl 2-heptylundecanoate (CID 169320459) is 2-[4-(dimethylamino)-2-methylbutanoyl]oxyundecyl 2-heptylundecanoate.
What is the SMILES notation for 2-[4-(dimethylamino)-2-methylbutanoyl]oxyundecyl 2-heptylundecanoate?
The canonical SMILES for 2-[4-(dimethylamino)-2-methylbutanoyl]oxyundecyl 2-heptylundecanoate is CCCCCCCCCC(COC(=O)C(CCCCCCC)CCCCCCCCC)OC(=O)C(C)CCN(C)C.
What is the InChIKey of 2-[4-(dimethylamino)-2-methylbutanoyl]oxyundecyl 2-heptylundecanoate?
The InChIKey is BGEOTTNKZMHCBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H71NO4/c1-7-10-13-16-18-21-24-27-33(26-23-20-15-12-9-3)36(39)40-31-34(28-25-22-19-17-14-11-8-2)41-35(38)32(4)29-30-37(5)6/h32-34H,7-31H2,1-6H3.
What are the key properties of 2-[4-(dimethylamino)-2-methylbutanoyl]oxyundecyl 2-heptylundecanoate?
2-[4-(dimethylamino)-2-methylbutanoyl]oxyundecyl 2-heptylundecanoate has a molecular weight of 581.97 g/mol, XLogP of 10.29, 30 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(dimethylamino)-2-methylbutanoyl]oxyundecyl 2-heptylundecanoate is sourced from PubChem (CID 169320459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).