C21H18FN3O2 — CID 169320875
7-amino-4-(5-fluoro-2-pyridinyl)-6-(3-hydroxy-2,6-dimethylphenyl)-2,3-dihydroisoindol-1-one (PubChem CID 169320875) has the molecular formula C21H18FN3O2 and a molecular weight of 363.39 g/mol. Its IUPAC name is 7-amino-4-(5-fluoro-2-pyridinyl)-6-(3-hydroxy-2,6-dimethylphenyl)-2,3-dihydroisoindol-1-one.
| Compound Name | 7-amino-4-(5-fluoro-2-pyridinyl)-6-(3-hydroxy-2,6-dimethylphenyl)-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 169320875 |
| Molecular Formula | C21H18FN3O2 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 7-amino-4-(5-fluoro-2-pyridinyl)-6-(3-hydroxy-2,6-dimethylphenyl)-2,3-dihydroisoindol-1-one |
| SMILES | Cc1ccc(O)c(C)c1-c1cc(-c2ccc(F)cn2)c2c(c1N)C(=O)NC2 |
| InChI | InChI=1S/C21H18FN3O2/c1-10-3-6-17(26)11(2)18(10)14-7-13(16-5-4-12(22)8-24-16)15-9-25-21(27)19(15)20(14)23/h3-8,26H,9,23H2,1-2H3,(H,25,27) |
| InChIKey | XAGRSVMITZTEJE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|