C24H33Cl2F3N4O3S — CID 169321220
N-[[(2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]morpholin-2-yl]methyl]-1,1,1-trifluoromethanesulfonamide;hydrochloride (PubChem CID 169321220) has the molecular formula C24H33Cl2F3N4O3S and a molecular weight of 585.52 g/mol. Its IUPAC name is N-[[(2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]morpholin-2-yl]methyl]-1,1,1-trifluoromethanesulfonamide;hydrochloride.
| Compound Name | N-[[(2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]morpholin-2-yl]methyl]-1,1,1-trifluoromethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 169321220 |
| Molecular Formula | C24H33Cl2F3N4O3S |
| Molecular Weight | 585.52 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | N-[[(2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]morpholin-2-yl]methyl]-1,1,1-trifluoromethanesulfonamide;hydrochloride |
| SMILES | Cc1cc(C2CCC(N3C[C@H](CNS(=O)(=O)C(F)(F)F)OC[C@@H]3Cc3ccc(Cl)cc3)CC2)nn1C.Cl |
| InChI | InChI=1S/C24H32ClF3N4O3S.ClH/c1-16-11-23(30-31(16)2)18-5-9-20(10-6-18)32-14-22(13-29-36(33,34)24(26,27)28)35-15-21(32)12-17-3-7-19(25)8-4-17;/h3-4,7-8,11,18,20-22,29H,5-6,9-10,12-15H2,1-2H3;1H/t18?,20?,21-,22-;/m0./s1 |
| InChIKey | NJZZJZJRUWXLSC-MXFXHJIRSA-N |
| XLogP | 4.58 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |