C39H74O5 — CID 169321325
didecyl 2,2,14,14-tetramethyl-8-oxopentadecanedioate (PubChem CID 169321325) has the molecular formula C39H74O5 and a molecular weight of 623.02 g/mol. Its IUPAC name is didecyl 2,2,14,14-tetramethyl-8-oxopentadecanedioate.
| Compound Name | didecyl 2,2,14,14-tetramethyl-8-oxopentadecanedioate |
|---|---|
| PubChem CID | 169321325 |
| Molecular Formula | C39H74O5 |
| Molecular Weight | 623.02 g/mol |
| Exact Mass | 622.55 |
| IUPAC Name | didecyl 2,2,14,14-tetramethyl-8-oxopentadecanedioate |
| SMILES | CCCCCCCCCCOC(=O)C(C)(C)CCCCCC(=O)CCCCCC(C)(C)C(=O)OCCCCCCCCCC |
| InChI | InChI=1S/C39H74O5/c1-7-9-11-13-15-17-19-27-33-43-36(41)38(3,4)31-25-21-23-29-35(40)30-24-22-26-32-39(5,6)37(42)44-34-28-20-18-16-14-12-10-8-2/h7-34H2,1-6H3 |
| InChIKey | UQGNLNRYXMSXCN-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.02 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|