About cis-benzyl (1S,2R)-2-(chloroamino)cyclopentane-1-carboxylate
cis-benzyl (1S,2R)-2-(chloroamino)cyclopentane-1-carboxylate (PubChem CID 169321795) has the molecular formula C13H16ClNO2
and a molecular weight of 253.73 g/mol. Its IUPAC name is cis-benzyl (1S,2R)-2-(chloroamino)cyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | cis-benzyl (1S,2R)-2-(chloroamino)cyclopentane-1-carboxylate |
| PubChem CID | 169321795 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | cis-benzyl (1S,2R)-2-(chloroamino)cyclopentane-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@H]1CCC[C@H]1NCl |
| InChI | InChI=1S/C13H16ClNO2/c14-15-12-8-4-7-11(12)13(16)17-9-10-5-2-1-3-6-10/h1-3,5-6,11-12,15H,4,7-9H2/t11-,12+/m0/s1 |
| InChIKey | KDJKIYHGQCAQPW-NWDGAFQWSA-N |
| XLogP | 2.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze cis-benzyl (1S,2R)-2-(chloroamino)cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-benzyl (1S,2R)-2-(chloroamino)cyclopentane-1-carboxylate?
The IUPAC name of cis-benzyl (1S,2R)-2-(chloroamino)cyclopentane-1-carboxylate (CID 169321795) is cis-benzyl (1S,2R)-2-(chloroamino)cyclopentane-1-carboxylate.
What is the SMILES notation for cis-benzyl (1S,2R)-2-(chloroamino)cyclopentane-1-carboxylate?
The canonical SMILES for cis-benzyl (1S,2R)-2-(chloroamino)cyclopentane-1-carboxylate is O=C(OCc1ccccc1)[C@H]1CCC[C@H]1NCl.
What is the InChIKey of cis-benzyl (1S,2R)-2-(chloroamino)cyclopentane-1-carboxylate?
The InChIKey is KDJKIYHGQCAQPW-NWDGAFQWSA-N. The full InChI is InChI=1S/C13H16ClNO2/c14-15-12-8-4-7-11(12)13(16)17-9-10-5-2-1-3-6-10/h1-3,5-6,11-12,15H,4,7-9H2/t11-,12+/m0/s1.
What are the key properties of cis-benzyl (1S,2R)-2-(chloroamino)cyclopentane-1-carboxylate?
cis-benzyl (1S,2R)-2-(chloroamino)cyclopentane-1-carboxylate has a molecular weight of 253.73 g/mol, XLogP of 2.64, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-benzyl (1S,2R)-2-(chloroamino)cyclopentane-1-carboxylate is sourced from PubChem (CID 169321795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).