C17H16O2 — CID 169322291
tritio-[4-[2-(2-tritiocarbonylphenyl)propan-2-yl]phenyl]methanone (PubChem CID 169322291) has the molecular formula C17H16O2 and a molecular weight of 256.33 g/mol. Its IUPAC name is tritio-[4-[2-(2-tritiocarbonylphenyl)propan-2-yl]phenyl]methanone.
| Compound Name | tritio-[4-[2-(2-tritiocarbonylphenyl)propan-2-yl]phenyl]methanone |
|---|---|
| PubChem CID | 169322291 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | tritio-[4-[2-(2-tritiocarbonylphenyl)propan-2-yl]phenyl]methanone |
| SMILES | [3H]C(=O)c1ccc(C(C)(C)c2ccccc2C([3H])=O)cc1 |
| InChI | InChI=1S/C17H16O2/c1-17(2,15-9-7-13(11-18)8-10-15)16-6-4-3-5-14(16)12-19/h3-12H,1-2H3/i11T,12T |
| InChIKey | ZSCCEKHTVMQVTI-GHUTVULXSA-N |
| XLogP | 3.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|