C9H15FO2 — CID 169322500
(3S,3aS,6S,6aR)-6-fluoro-3-propan-2-yl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 169322500) has the molecular formula C9H15FO2 and a molecular weight of 174.21 g/mol. Its IUPAC name is (3S,3aS,6S,6aR)-6-fluoro-3-propan-2-yl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (3S,3aS,6S,6aR)-6-fluoro-3-propan-2-yl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 169322500 |
| Molecular Formula | C9H15FO2 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | (3S,3aS,6S,6aR)-6-fluoro-3-propan-2-yl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | CC(C)[C@H]1CO[C@@H]2[C@H]1OC[C@@H]2F |
| InChI | InChI=1S/C9H15FO2/c1-5(2)6-3-11-9-7(10)4-12-8(6)9/h5-9H,3-4H2,1-2H3/t6-,7+,8+,9+/m1/s1 |
| InChIKey | SCRWCVORJQZADZ-XGEHTFHBSA-N |
| XLogP | 1.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |