C9H14F2O2 — CID 169322504
(3R,3aS,6aR)-6,6-difluoro-3-propan-2-yl-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan (PubChem CID 169322504) has the molecular formula C9H14F2O2 and a molecular weight of 192.20 g/mol. Its IUPAC name is (3R,3aS,6aR)-6,6-difluoro-3-propan-2-yl-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan.
| Compound Name | (3R,3aS,6aR)-6,6-difluoro-3-propan-2-yl-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan |
|---|---|
| PubChem CID | 169322504 |
| Molecular Formula | C9H14F2O2 |
| Molecular Weight | 192.20 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | (3R,3aS,6aR)-6,6-difluoro-3-propan-2-yl-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan |
| SMILES | CC(C)[C@@H]1CO[C@@H]2[C@H]1OCC2(F)F |
| InChI | InChI=1S/C9H14F2O2/c1-5(2)6-3-12-8-7(6)13-4-9(8,10)11/h5-8H,3-4H2,1-2H3/t6-,7-,8+/m0/s1 |
| InChIKey | BCZOFPQUDATBEV-BIIVOSGPSA-N |
| XLogP | 1.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.20 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |