C31H30F2N3O4Si+ — CID 169322740
[7-(dimethylamino)-10-[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-2,6-difluorophenyl]-5-ethenyl-5-methylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium (PubChem CID 169322740) has the molecular formula C31H30F2N3O4Si+ and a molecular weight of 574.68 g/mol. Its IUPAC name is [7-(dimethylamino)-10-[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-2,6-difluorophenyl]-5-ethenyl-5-methylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium.
| Compound Name | [7-(dimethylamino)-10-[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-2,6-difluorophenyl]-5-ethenyl-5-methylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 169322740 |
| Molecular Formula | C31H30F2N3O4Si+ |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.20 |
| IUPAC Name | [7-(dimethylamino)-10-[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-2,6-difluorophenyl]-5-ethenyl-5-methylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
| SMILES | C=C[Si]1(C)C2=CC(=[N+](C)C)C=CC2=C(c2c(F)cc(C(=O)ON3C(=O)CCC3=O)cc2F)c2ccc(N(C)C)cc21 |
| InChI | InChI=1S/C31H30F2N3O4Si/c1-7-41(6)25-16-19(34(2)3)8-10-21(25)29(22-11-9-20(35(4)5)17-26(22)41)30-23(32)14-18(15-24(30)33)31(39)40-36-27(37)12-13-28(36)38/h7-11,14-17H,1,12-13H2,2-6H3/q+1 |
| InChIKey | OQDSGTWEHSFHTN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 69.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|