C30H30F2N3O4Si+ — CID 169322746
[7-(dimethylamino)-10-[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-2,6-difluorophenyl]-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium (PubChem CID 169322746) has the molecular formula C30H30F2N3O4Si+ and a molecular weight of 562.67 g/mol. Its IUPAC name is [7-(dimethylamino)-10-[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-2,6-difluorophenyl]-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium.
| Compound Name | [7-(dimethylamino)-10-[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-2,6-difluorophenyl]-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 169322746 |
| Molecular Formula | C30H30F2N3O4Si+ |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | [7-(dimethylamino)-10-[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-2,6-difluorophenyl]-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc2c(c1)[Si](C)(C)C1=CC(=[N+](C)C)C=CC1=C2c1c(F)cc(C(=O)ON2C(=O)CCC2=O)cc1F |
| InChI | InChI=1S/C30H30F2N3O4Si/c1-33(2)18-7-9-20-24(15-18)40(5,6)25-16-19(34(3)4)8-10-21(25)28(20)29-22(31)13-17(14-23(29)32)30(38)39-35-26(36)11-12-27(35)37/h7-10,13-16H,11-12H2,1-6H3/q+1 |
| InChIKey | LUSDBTKABLLWEN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 69.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|