C21H5N7S — CID 169324095
2-[4-cyano-11-(dicyanomethylidene)naphtho[2,3-g][2,1,3]benzothiadiazol-6-ylidene]propanedinitrile (PubChem CID 169324095) has the molecular formula C21H5N7S and a molecular weight of 387.39 g/mol. Its IUPAC name is 2-[4-cyano-11-(dicyanomethylidene)naphtho[2,3-g][2,1,3]benzothiadiazol-6-ylidene]propanedinitrile.
| Compound Name | 2-[4-cyano-11-(dicyanomethylidene)naphtho[2,3-g][2,1,3]benzothiadiazol-6-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 169324095 |
| Molecular Formula | C21H5N7S |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 2-[4-cyano-11-(dicyanomethylidene)naphtho[2,3-g][2,1,3]benzothiadiazol-6-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=c1c2ccccc2c(=C(C#N)C#N)c2c1cc(C#N)c1nsnc12 |
| InChI | InChI=1S/C21H5N7S/c22-6-11-5-16-17(12(7-23)8-24)14-3-1-2-4-15(14)18(13(9-25)10-26)19(16)21-20(11)27-29-28-21/h1-5H |
| InChIKey | UZRSQWPUKORQEN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 144.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|