C16H21N5O3 — CID 169324581
[5-(5-formyl-6-methyl-2-pyridinyl)-3-methyltriazol-4-yl]methyl N-methyl-N-propylcarbamate (PubChem CID 169324581) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is [5-(5-formyl-6-methyl-2-pyridinyl)-3-methyltriazol-4-yl]methyl N-methyl-N-propylcarbamate.
| Compound Name | [5-(5-formyl-6-methyl-2-pyridinyl)-3-methyltriazol-4-yl]methyl N-methyl-N-propylcarbamate |
|---|---|
| PubChem CID | 169324581 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | [5-(5-formyl-6-methyl-2-pyridinyl)-3-methyltriazol-4-yl]methyl N-methyl-N-propylcarbamate |
| SMILES | CCCN(C)C(=O)OCc1c(-c2ccc(C=O)c(C)n2)nnn1C |
| InChI | InChI=1S/C16H21N5O3/c1-5-8-20(3)16(23)24-10-14-15(18-19-21(14)4)13-7-6-12(9-22)11(2)17-13/h6-7,9H,5,8,10H2,1-4H3 |
| InChIKey | SEBYADUDYPARMM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|