About 1-(7-azido-2,3-dihydro-1,4-benzodioxin-6-yl)tetrazole
1-(7-azido-2,3-dihydro-1,4-benzodioxin-6-yl)tetrazole (PubChem CID 169326592) has the molecular formula C9H7N7O2
and a molecular weight of 245.20 g/mol. Its IUPAC name is 1-(7-azido-2,3-dihydro-1,4-benzodioxin-6-yl)tetrazole.
Molecular Properties
| Compound Name | 1-(7-azido-2,3-dihydro-1,4-benzodioxin-6-yl)tetrazole |
| PubChem CID | 169326592 |
| Molecular Formula | C9H7N7O2 |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 1-(7-azido-2,3-dihydro-1,4-benzodioxin-6-yl)tetrazole |
| SMILES | [N-]=[N+]=Nc1cc2c(cc1-n1cnnn1)OCCO2 |
| InChI | InChI=1S/C9H7N7O2/c10-13-12-6-3-8-9(18-2-1-17-8)4-7(6)16-5-11-14-15-16/h3-5H,1-2H2 |
| InChIKey | HSUYFYBMUNCFMA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 110.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(7-azido-2,3-dihydro-1,4-benzodioxin-6-yl)tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-azido-2,3-dihydro-1,4-benzodioxin-6-yl)tetrazole?
The IUPAC name of 1-(7-azido-2,3-dihydro-1,4-benzodioxin-6-yl)tetrazole (CID 169326592) is 1-(7-azido-2,3-dihydro-1,4-benzodioxin-6-yl)tetrazole.
What is the SMILES notation for 1-(7-azido-2,3-dihydro-1,4-benzodioxin-6-yl)tetrazole?
The canonical SMILES for 1-(7-azido-2,3-dihydro-1,4-benzodioxin-6-yl)tetrazole is [N-]=[N+]=Nc1cc2c(cc1-n1cnnn1)OCCO2.
What is the InChIKey of 1-(7-azido-2,3-dihydro-1,4-benzodioxin-6-yl)tetrazole?
The InChIKey is HSUYFYBMUNCFMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N7O2/c10-13-12-6-3-8-9(18-2-1-17-8)4-7(6)16-5-11-14-15-16/h3-5H,1-2H2.
What are the key properties of 1-(7-azido-2,3-dihydro-1,4-benzodioxin-6-yl)tetrazole?
1-(7-azido-2,3-dihydro-1,4-benzodioxin-6-yl)tetrazole has a molecular weight of 245.20 g/mol, XLogP of 1.38, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-azido-2,3-dihydro-1,4-benzodioxin-6-yl)tetrazole is sourced from PubChem (CID 169326592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).