C22H22N4O2S — CID 16932667
N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-thiophen-3-ylethyl]-N'-pyridin-4-yloxamide (PubChem CID 16932667) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-thiophen-3-ylethyl]-N'-pyridin-4-yloxamide.
| Compound Name | N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-thiophen-3-ylethyl]-N'-pyridin-4-yloxamide |
|---|---|
| PubChem CID | 16932667 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-thiophen-3-ylethyl]-N'-pyridin-4-yloxamide |
| SMILES | O=C(NCC(c1ccsc1)N1CCc2ccccc2C1)C(=O)Nc1ccncc1 |
| InChI | InChI=1S/C22H22N4O2S/c27-21(22(28)25-19-5-9-23-10-6-19)24-13-20(18-8-12-29-15-18)26-11-7-16-3-1-2-4-17(16)14-26/h1-6,8-10,12,15,20H,7,11,13-14H2,(H,24,27)(H,23,25,28) |
| InChIKey | XXZORHDLXZUQHC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|