C13H7F2N3O4 — CID 169328619
4-amino-5-(3,4-difluoro-5-hydroxyphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169328619) has the molecular formula C13H7F2N3O4 and a molecular weight of 307.21 g/mol. Its IUPAC name is 4-amino-5-(3,4-difluoro-5-hydroxyphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-(3,4-difluoro-5-hydroxyphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169328619 |
| Molecular Formula | C13H7F2N3O4 |
| Molecular Weight | 307.21 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 4-amino-5-(3,4-difluoro-5-hydroxyphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1cc(O)c(F)c(F)c1)C(=O)NC2=O |
| InChI | InChI=1S/C13H7F2N3O4/c14-6-1-4(2-7(19)10(6)15)18-8(20)3-5-9(11(18)16)13(22)17-12(5)21/h1-3,19H,16H2,(H,17,21,22) |
| InChIKey | KESOPVLZUPIFCJ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.21 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|