C15H7F4N3O5 — CID 169330606
4-amino-5-(2,2,4,4-tetrafluoro-1,3-benzodioxin-6-yl)pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169330606) has the molecular formula C15H7F4N3O5 and a molecular weight of 385.23 g/mol. Its IUPAC name is 4-amino-5-(2,2,4,4-tetrafluoro-1,3-benzodioxin-6-yl)pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-(2,2,4,4-tetrafluoro-1,3-benzodioxin-6-yl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169330606 |
| Molecular Formula | C15H7F4N3O5 |
| Molecular Weight | 385.23 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 4-amino-5-(2,2,4,4-tetrafluoro-1,3-benzodioxin-6-yl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1ccc3c(c1)C(F)(F)OC(F)(F)O3)C(=O)NC2=O |
| InChI | InChI=1S/C15H7F4N3O5/c16-14(17)7-3-5(1-2-8(7)26-15(18,19)27-14)22-9(23)4-6-10(11(22)20)13(25)21-12(6)24/h1-4H,20H2,(H,21,24,25) |
| InChIKey | JAJZDMCVRZGJCZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|