C19H13N3O3 — CID 169332774
5-[2-[(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl]phenyl]furan-2-carbaldehyde (PubChem CID 169332774) has the molecular formula C19H13N3O3 and a molecular weight of 331.33 g/mol. Its IUPAC name is 5-[2-[(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl]phenyl]furan-2-carbaldehyde.
| Compound Name | 5-[2-[(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl]phenyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169332774 |
| Molecular Formula | C19H13N3O3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 5-[2-[(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl]phenyl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2ccccc2Cc2nc(-c3cccnc3)no2)o1 |
| InChI | InChI=1S/C19H13N3O3/c23-12-15-7-8-17(24-15)16-6-2-1-4-13(16)10-18-21-19(22-25-18)14-5-3-9-20-11-14/h1-9,11-12H,10H2 |
| InChIKey | IKYKIIXJVZKMMD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 82.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|