About 5-[3,5-dichloro-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]furan-2-carbaldehyde
5-[3,5-dichloro-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]furan-2-carbaldehyde (PubChem CID 169333045) has the molecular formula C17H8Cl2F3NO3
and a molecular weight of 402.16 g/mol. Its IUPAC name is 5-[3,5-dichloro-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]furan-2-carbaldehyde.
Molecular Properties
| Compound Name | 5-[3,5-dichloro-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]furan-2-carbaldehyde |
| PubChem CID | 169333045 |
| Molecular Formula | C17H8Cl2F3NO3 |
| Molecular Weight | 402.16 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | 5-[3,5-dichloro-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2cc(Cl)c(Oc3ccc(C(F)(F)F)cn3)c(Cl)c2)o1 |
| InChI | InChI=1S/C17H8Cl2F3NO3/c18-12-5-9(14-3-2-11(8-24)25-14)6-13(19)16(12)26-15-4-1-10(7-23-15)17(20,21)22/h1-8H |
| InChIKey | QGADYPZACJVECN-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.16 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-[3,5-dichloro-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]furan-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3,5-dichloro-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]furan-2-carbaldehyde?
The IUPAC name of 5-[3,5-dichloro-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]furan-2-carbaldehyde (CID 169333045) is 5-[3,5-dichloro-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]furan-2-carbaldehyde.
What is the SMILES notation for 5-[3,5-dichloro-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]furan-2-carbaldehyde?
The canonical SMILES for 5-[3,5-dichloro-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]furan-2-carbaldehyde is O=Cc1ccc(-c2cc(Cl)c(Oc3ccc(C(F)(F)F)cn3)c(Cl)c2)o1.
What is the InChIKey of 5-[3,5-dichloro-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]furan-2-carbaldehyde?
The InChIKey is QGADYPZACJVECN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H8Cl2F3NO3/c18-12-5-9(14-3-2-11(8-24)25-14)6-13(19)16(12)26-15-4-1-10(7-23-15)17(20,21)22/h1-8H.
What are the key properties of 5-[3,5-dichloro-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]furan-2-carbaldehyde?
5-[3,5-dichloro-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]furan-2-carbaldehyde has a molecular weight of 402.16 g/mol, XLogP of 6.27, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3,5-dichloro-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]furan-2-carbaldehyde is sourced from PubChem (CID 169333045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).