C19H15ClF3N3O2 — CID 169333603
5-[2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]phenyl]furan-2-carbaldehyde (PubChem CID 169333603) has the molecular formula C19H15ClF3N3O2 and a molecular weight of 409.80 g/mol. Its IUPAC name is 5-[2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]phenyl]furan-2-carbaldehyde.
| Compound Name | 5-[2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]phenyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169333603 |
| Molecular Formula | C19H15ClF3N3O2 |
| Molecular Weight | 409.80 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 5-[2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]phenyl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2ccccc2NCCNc2ncc(C(F)(F)F)cc2Cl)o1 |
| InChI | InChI=1S/C19H15ClF3N3O2/c20-15-9-12(19(21,22)23)10-26-18(15)25-8-7-24-16-4-2-1-3-14(16)17-6-5-13(11-27)28-17/h1-6,9-11,24H,7-8H2,(H,25,26) |
| InChIKey | QUTNDLVNOOKPNK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.80 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|