About 5-[2-methyl-3-(2-oxo-1,3-diazinan-1-yl)phenyl]furan-2-carbaldehyde
5-[2-methyl-3-(2-oxo-1,3-diazinan-1-yl)phenyl]furan-2-carbaldehyde (PubChem CID 169334453) has the molecular formula C16H16N2O3
and a molecular weight of 284.31 g/mol. Its IUPAC name is 5-[2-methyl-3-(2-oxo-1,3-diazinan-1-yl)phenyl]furan-2-carbaldehyde.
Molecular Properties
| Compound Name | 5-[2-methyl-3-(2-oxo-1,3-diazinan-1-yl)phenyl]furan-2-carbaldehyde |
| PubChem CID | 169334453 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 5-[2-methyl-3-(2-oxo-1,3-diazinan-1-yl)phenyl]furan-2-carbaldehyde |
| SMILES | Cc1c(-c2ccc(C=O)o2)cccc1N1CCCNC1=O |
| InChI | InChI=1S/C16H16N2O3/c1-11-13(15-7-6-12(10-19)21-15)4-2-5-14(11)18-9-3-8-17-16(18)20/h2,4-7,10H,3,8-9H2,1H3,(H,17,20) |
| InChIKey | VXFNKVYYZLTJQR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-methyl-3-(2-oxo-1,3-diazinan-1-yl)phenyl]furan-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-methyl-3-(2-oxo-1,3-diazinan-1-yl)phenyl]furan-2-carbaldehyde?
The IUPAC name of 5-[2-methyl-3-(2-oxo-1,3-diazinan-1-yl)phenyl]furan-2-carbaldehyde (CID 169334453) is 5-[2-methyl-3-(2-oxo-1,3-diazinan-1-yl)phenyl]furan-2-carbaldehyde.
What is the SMILES notation for 5-[2-methyl-3-(2-oxo-1,3-diazinan-1-yl)phenyl]furan-2-carbaldehyde?
The canonical SMILES for 5-[2-methyl-3-(2-oxo-1,3-diazinan-1-yl)phenyl]furan-2-carbaldehyde is Cc1c(-c2ccc(C=O)o2)cccc1N1CCCNC1=O.
What is the InChIKey of 5-[2-methyl-3-(2-oxo-1,3-diazinan-1-yl)phenyl]furan-2-carbaldehyde?
The InChIKey is VXFNKVYYZLTJQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O3/c1-11-13(15-7-6-12(10-19)21-15)4-2-5-14(11)18-9-3-8-17-16(18)20/h2,4-7,10H,3,8-9H2,1H3,(H,17,20).
What are the key properties of 5-[2-methyl-3-(2-oxo-1,3-diazinan-1-yl)phenyl]furan-2-carbaldehyde?
5-[2-methyl-3-(2-oxo-1,3-diazinan-1-yl)phenyl]furan-2-carbaldehyde has a molecular weight of 284.31 g/mol, XLogP of 2.99, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-methyl-3-(2-oxo-1,3-diazinan-1-yl)phenyl]furan-2-carbaldehyde is sourced from PubChem (CID 169334453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).