About 5-[2-(4,5-dimethyl-1,3-oxazol-2-yl)phenyl]furan-2-carbaldehyde
5-[2-(4,5-dimethyl-1,3-oxazol-2-yl)phenyl]furan-2-carbaldehyde (PubChem CID 169334656) has the molecular formula C16H13NO3
and a molecular weight of 267.28 g/mol. Its IUPAC name is 5-[2-(4,5-dimethyl-1,3-oxazol-2-yl)phenyl]furan-2-carbaldehyde.
Molecular Properties
| Compound Name | 5-[2-(4,5-dimethyl-1,3-oxazol-2-yl)phenyl]furan-2-carbaldehyde |
| PubChem CID | 169334656 |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 5-[2-(4,5-dimethyl-1,3-oxazol-2-yl)phenyl]furan-2-carbaldehyde |
| SMILES | Cc1nc(-c2ccccc2-c2ccc(C=O)o2)oc1C |
| InChI | InChI=1S/C16H13NO3/c1-10-11(2)19-16(17-10)14-6-4-3-5-13(14)15-8-7-12(9-18)20-15/h3-9H,1-2H3 |
| InChIKey | BNYSQFWUMLUTPG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(4,5-dimethyl-1,3-oxazol-2-yl)phenyl]furan-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(4,5-dimethyl-1,3-oxazol-2-yl)phenyl]furan-2-carbaldehyde?
The IUPAC name of 5-[2-(4,5-dimethyl-1,3-oxazol-2-yl)phenyl]furan-2-carbaldehyde (CID 169334656) is 5-[2-(4,5-dimethyl-1,3-oxazol-2-yl)phenyl]furan-2-carbaldehyde.
What is the SMILES notation for 5-[2-(4,5-dimethyl-1,3-oxazol-2-yl)phenyl]furan-2-carbaldehyde?
The canonical SMILES for 5-[2-(4,5-dimethyl-1,3-oxazol-2-yl)phenyl]furan-2-carbaldehyde is Cc1nc(-c2ccccc2-c2ccc(C=O)o2)oc1C.
What is the InChIKey of 5-[2-(4,5-dimethyl-1,3-oxazol-2-yl)phenyl]furan-2-carbaldehyde?
The InChIKey is BNYSQFWUMLUTPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO3/c1-10-11(2)19-16(17-10)14-6-4-3-5-13(14)15-8-7-12(9-18)20-15/h3-9H,1-2H3.
What are the key properties of 5-[2-(4,5-dimethyl-1,3-oxazol-2-yl)phenyl]furan-2-carbaldehyde?
5-[2-(4,5-dimethyl-1,3-oxazol-2-yl)phenyl]furan-2-carbaldehyde has a molecular weight of 267.28 g/mol, XLogP of 4.03, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(4,5-dimethyl-1,3-oxazol-2-yl)phenyl]furan-2-carbaldehyde is sourced from PubChem (CID 169334656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).