C17H13NO3 — CID 169335064
5-(8-oxo-5,6,7,9-tetrahydrocarbazol-2-yl)furan-2-carbaldehyde (PubChem CID 169335064) has the molecular formula C17H13NO3 and a molecular weight of 279.30 g/mol. Its IUPAC name is 5-(8-oxo-5,6,7,9-tetrahydrocarbazol-2-yl)furan-2-carbaldehyde.
| Compound Name | 5-(8-oxo-5,6,7,9-tetrahydrocarbazol-2-yl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169335064 |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 5-(8-oxo-5,6,7,9-tetrahydrocarbazol-2-yl)furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2ccc3c4c([nH]c3c2)C(=O)CCC4)o1 |
| InChI | InChI=1S/C17H13NO3/c19-9-11-5-7-16(21-11)10-4-6-12-13-2-1-3-15(20)17(13)18-14(12)8-10/h4-9,18H,1-3H2 |
| InChIKey | XRRVOOSVTLZSAG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|