C20H17NO4 — CID 169335250
2-(5-formylfuran-2-yl)-N-[(4-methoxyphenyl)methyl]benzamide (PubChem CID 169335250) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-(5-formylfuran-2-yl)-N-[(4-methoxyphenyl)methyl]benzamide.
| Compound Name | 2-(5-formylfuran-2-yl)-N-[(4-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 169335250 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-(5-formylfuran-2-yl)-N-[(4-methoxyphenyl)methyl]benzamide |
| SMILES | COc1ccc(CNC(=O)c2ccccc2-c2ccc(C=O)o2)cc1 |
| InChI | InChI=1S/C20H17NO4/c1-24-15-8-6-14(7-9-15)12-21-20(23)18-5-3-2-4-17(18)19-11-10-16(13-22)25-19/h2-11,13H,12H2,1H3,(H,21,23) |
| InChIKey | ZLVFXXZLEYJTAM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|