C12H7NO3 — CID 169335702
5-(1,2-benzoxazol-6-yl)furan-2-carbaldehyde (PubChem CID 169335702) has the molecular formula C12H7NO3 and a molecular weight of 213.19 g/mol. Its IUPAC name is 5-(1,2-benzoxazol-6-yl)furan-2-carbaldehyde.
| Compound Name | 5-(1,2-benzoxazol-6-yl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169335702 |
| Molecular Formula | C12H7NO3 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 5-(1,2-benzoxazol-6-yl)furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2ccc3cnoc3c2)o1 |
| InChI | InChI=1S/C12H7NO3/c14-7-10-3-4-11(15-10)8-1-2-9-6-13-16-12(9)5-8/h1-7H |
| InChIKey | XZINJUDWUSWMKB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|