About 2-[[4-(3-methyl-1,2,4-triazol-1-yl)phenyl]hydrazinylidene]propanedinitrile
2-[[4-(3-methyl-1,2,4-triazol-1-yl)phenyl]hydrazinylidene]propanedinitrile (PubChem CID 169340029) has the molecular formula C12H9N7
and a molecular weight of 251.25 g/mol. Its IUPAC name is 2-[[4-(3-methyl-1,2,4-triazol-1-yl)phenyl]hydrazinylidene]propanedinitrile.
Molecular Properties
| Compound Name | 2-[[4-(3-methyl-1,2,4-triazol-1-yl)phenyl]hydrazinylidene]propanedinitrile |
| PubChem CID | 169340029 |
| Molecular Formula | C12H9N7 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 2-[[4-(3-methyl-1,2,4-triazol-1-yl)phenyl]hydrazinylidene]propanedinitrile |
| SMILES | Cc1ncn(-c2ccc(NN=C(C#N)C#N)cc2)n1 |
| InChI | InChI=1S/C12H9N7/c1-9-15-8-19(18-9)12-4-2-10(3-5-12)16-17-11(6-13)7-14/h2-5,8,16H,1H3 |
| InChIKey | LAARRJPGOCRPAB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-(3-methyl-1,2,4-triazol-1-yl)phenyl]hydrazinylidene]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(3-methyl-1,2,4-triazol-1-yl)phenyl]hydrazinylidene]propanedinitrile?
The IUPAC name of 2-[[4-(3-methyl-1,2,4-triazol-1-yl)phenyl]hydrazinylidene]propanedinitrile (CID 169340029) is 2-[[4-(3-methyl-1,2,4-triazol-1-yl)phenyl]hydrazinylidene]propanedinitrile.
What is the SMILES notation for 2-[[4-(3-methyl-1,2,4-triazol-1-yl)phenyl]hydrazinylidene]propanedinitrile?
The canonical SMILES for 2-[[4-(3-methyl-1,2,4-triazol-1-yl)phenyl]hydrazinylidene]propanedinitrile is Cc1ncn(-c2ccc(NN=C(C#N)C#N)cc2)n1.
What is the InChIKey of 2-[[4-(3-methyl-1,2,4-triazol-1-yl)phenyl]hydrazinylidene]propanedinitrile?
The InChIKey is LAARRJPGOCRPAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N7/c1-9-15-8-19(18-9)12-4-2-10(3-5-12)16-17-11(6-13)7-14/h2-5,8,16H,1H3.
What are the key properties of 2-[[4-(3-methyl-1,2,4-triazol-1-yl)phenyl]hydrazinylidene]propanedinitrile?
2-[[4-(3-methyl-1,2,4-triazol-1-yl)phenyl]hydrazinylidene]propanedinitrile has a molecular weight of 251.25 g/mol, XLogP of 1.39, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(3-methyl-1,2,4-triazol-1-yl)phenyl]hydrazinylidene]propanedinitrile is sourced from PubChem (CID 169340029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).