C9H3BrCl2N4 — CID 169341444
2-[(3-bromo-2,4-dichlorophenyl)hydrazinylidene]propanedinitrile (PubChem CID 169341444) has the molecular formula C9H3BrCl2N4 and a molecular weight of 317.96 g/mol. Its IUPAC name is 2-[(3-bromo-2,4-dichlorophenyl)hydrazinylidene]propanedinitrile.
| Compound Name | 2-[(3-bromo-2,4-dichlorophenyl)hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169341444 |
| Molecular Formula | C9H3BrCl2N4 |
| Molecular Weight | 317.96 g/mol |
| Exact Mass | 315.89 |
| IUPAC Name | 2-[(3-bromo-2,4-dichlorophenyl)hydrazinylidene]propanedinitrile |
| SMILES | N#CC(C#N)=NNc1ccc(Cl)c(Br)c1Cl |
| InChI | InChI=1S/C9H3BrCl2N4/c10-8-6(11)1-2-7(9(8)12)16-15-5(3-13)4-14/h1-2,16H |
| InChIKey | UTUFOEYJTSPZEJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 71.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.96 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|