C11H6BrFN6O2 — CID 169342993
3-bromo-4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-5-fluorobenzoic acid (PubChem CID 169342993) has the molecular formula C11H6BrFN6O2 and a molecular weight of 353.11 g/mol. Its IUPAC name is 3-bromo-4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-5-fluorobenzoic acid.
| Compound Name | 3-bromo-4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 169342993 |
| Molecular Formula | C11H6BrFN6O2 |
| Molecular Weight | 353.11 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | 3-bromo-4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-5-fluorobenzoic acid |
| SMILES | N#CC(=CNc1c(F)cc(C(=O)O)cc1Br)c1nn[nH]n1 |
| InChI | InChI=1S/C11H6BrFN6O2/c12-7-1-5(11(20)21)2-8(13)9(7)15-4-6(3-14)10-16-18-19-17-10/h1-2,4,15H,(H,20,21)(H,16,17,18,19) |
| InChIKey | CFFRZDRYSDVPAY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 127.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.11 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|