C16H15N9OS — CID 169343098
3-[2-(5-oxo-3-propylsulfanyl-4H-1,2,4-triazin-6-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169343098) has the molecular formula C16H15N9OS and a molecular weight of 381.43 g/mol. Its IUPAC name is 3-[2-(5-oxo-3-propylsulfanyl-4H-1,2,4-triazin-6-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[2-(5-oxo-3-propylsulfanyl-4H-1,2,4-triazin-6-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169343098 |
| Molecular Formula | C16H15N9OS |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 3-[2-(5-oxo-3-propylsulfanyl-4H-1,2,4-triazin-6-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | CCCSc1nnc(-c2ccccc2NC=C(C#N)c2nn[nH]n2)c(=O)[nH]1 |
| InChI | InChI=1S/C16H15N9OS/c1-2-7-27-16-19-15(26)13(20-23-16)11-5-3-4-6-12(11)18-9-10(8-17)14-21-24-25-22-14/h3-6,9,18H,2,7H2,1H3,(H,19,23,26)(H,21,22,24,25) |
| InChIKey | JVNSCOZBVRTSFL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 148.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|