C11H7BrClFN6 — CID 169343660
3-(2-bromo-6-chloro-4-fluoro-3-methylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169343660) has the molecular formula C11H7BrClFN6 and a molecular weight of 357.57 g/mol. Its IUPAC name is 3-(2-bromo-6-chloro-4-fluoro-3-methylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-(2-bromo-6-chloro-4-fluoro-3-methylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169343660 |
| Molecular Formula | C11H7BrClFN6 |
| Molecular Weight | 357.57 g/mol |
| Exact Mass | 355.96 |
| IUPAC Name | 3-(2-bromo-6-chloro-4-fluoro-3-methylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | Cc1c(F)cc(Cl)c(NC=C(C#N)c2nn[nH]n2)c1Br |
| InChI | InChI=1S/C11H7BrClFN6/c1-5-8(14)2-7(13)10(9(5)12)16-4-6(3-15)11-17-19-20-18-11/h2,4,16H,1H3,(H,17,18,19,20) |
| InChIKey | GJVNBZGVUDKVOM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.57 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|