C16H14N10S — CID 169343739
3-[3-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169343739) has the molecular formula C16H14N10S and a molecular weight of 378.43 g/mol. Its IUPAC name is 3-[3-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[3-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169343739 |
| Molecular Formula | C16H14N10S |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 3-[3-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | CCc1nnc2sc(-c3cccc(NC=C(C#N)c4nn[nH]n4)c3C)nn12 |
| InChI | InChI=1S/C16H14N10S/c1-3-13-19-22-16-26(13)23-15(27-16)11-5-4-6-12(9(11)2)18-8-10(7-17)14-20-24-25-21-14/h4-6,8,18H,3H2,1-2H3,(H,20,21,24,25) |
| InChIKey | VIUDRLQNRWTKTG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 133.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|