C12H6F4N6O2 — CID 169344261
3-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169344261) has the molecular formula C12H6F4N6O2 and a molecular weight of 342.21 g/mol. Its IUPAC name is 3-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169344261 |
| Molecular Formula | C12H6F4N6O2 |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 3-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1cccc2c1OC(F)(F)C(F)(F)O2)c1nn[nH]n1 |
| InChI | InChI=1S/C12H6F4N6O2/c13-11(14)12(15,16)24-9-7(2-1-3-8(9)23-11)18-5-6(4-17)10-19-21-22-20-10/h1-3,5,18H,(H,19,20,21,22) |
| InChIKey | ISZQHZHJXVVFLD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|