C13H10F3N7O — CID 169344516
3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 169344516) has the molecular formula C13H10F3N7O and a molecular weight of 337.27 g/mol. Its IUPAC name is 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 169344516 |
| Molecular Formula | C13H10F3N7O |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | N#CC(=CNc1cccc(C(=O)NCC(F)(F)F)c1)c1nn[nH]n1 |
| InChI | InChI=1S/C13H10F3N7O/c14-13(15,16)7-19-12(24)8-2-1-3-10(4-8)18-6-9(5-17)11-20-22-23-21-11/h1-4,6,18H,7H2,(H,19,24)(H,20,21,22,23) |
| InChIKey | BXYHSLAQMUVVNA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|