C14H10F3N7O — CID 169345353
2-(2H-tetrazol-5-yl)-3-[[1-(2,2,2-trifluoroacetyl)-2,3-dihydroindol-5-yl]amino]prop-2-enenitrile (PubChem CID 169345353) has the molecular formula C14H10F3N7O and a molecular weight of 349.28 g/mol. Its IUPAC name is 2-(2H-tetrazol-5-yl)-3-[[1-(2,2,2-trifluoroacetyl)-2,3-dihydroindol-5-yl]amino]prop-2-enenitrile.
| Compound Name | 2-(2H-tetrazol-5-yl)-3-[[1-(2,2,2-trifluoroacetyl)-2,3-dihydroindol-5-yl]amino]prop-2-enenitrile |
|---|---|
| PubChem CID | 169345353 |
| Molecular Formula | C14H10F3N7O |
| Molecular Weight | 349.28 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 2-(2H-tetrazol-5-yl)-3-[[1-(2,2,2-trifluoroacetyl)-2,3-dihydroindol-5-yl]amino]prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccc2c(c1)CCN2C(=O)C(F)(F)F)c1nn[nH]n1 |
| InChI | InChI=1S/C14H10F3N7O/c15-14(16,17)13(25)24-4-3-8-5-10(1-2-11(8)24)19-7-9(6-18)12-20-22-23-21-12/h1-2,5,7,19H,3-4H2,(H,20,21,22,23) |
| InChIKey | HBAGPVNPOQHVNB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 110.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|