C24H24N8O — CID 169346235
3-[4-[4-(3-phenylprop-2-enyl)piperazine-1-carbonyl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169346235) has the molecular formula C24H24N8O and a molecular weight of 440.51 g/mol. Its IUPAC name is 3-[4-[4-(3-phenylprop-2-enyl)piperazine-1-carbonyl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[4-[4-(3-phenylprop-2-enyl)piperazine-1-carbonyl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169346235 |
| Molecular Formula | C24H24N8O |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 3-[4-[4-(3-phenylprop-2-enyl)piperazine-1-carbonyl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccc(C(=O)N2CCN(CC=Cc3ccccc3)CC2)cc1)c1nn[nH]n1 |
| InChI | InChI=1S/C24H24N8O/c25-17-21(23-27-29-30-28-23)18-26-22-10-8-20(9-11-22)24(33)32-15-13-31(14-16-32)12-4-7-19-5-2-1-3-6-19/h1-11,18,26H,12-16H2,(H,27,28,29,30) |
| InChIKey | SZOVIFXECOVYQS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|