About 5-isocyanato-1,3-dihydrobenzimidazole-2-thione
5-isocyanato-1,3-dihydrobenzimidazole-2-thione (PubChem CID 169352100) has the molecular formula C8H5N3OS
and a molecular weight of 191.22 g/mol. Its IUPAC name is 5-isocyanato-1,3-dihydrobenzimidazole-2-thione.
Molecular Properties
| Compound Name | 5-isocyanato-1,3-dihydrobenzimidazole-2-thione |
| PubChem CID | 169352100 |
| Molecular Formula | C8H5N3OS |
| Molecular Weight | 191.22 g/mol |
| Exact Mass | 191.02 |
| IUPAC Name | 5-isocyanato-1,3-dihydrobenzimidazole-2-thione |
| SMILES | O=C=Nc1ccc2[nH]c(=S)[nH]c2c1 |
| InChI | InChI=1S/C8H5N3OS/c12-4-9-5-1-2-6-7(3-5)11-8(13)10-6/h1-3H,(H2,10,11,13) |
| InChIKey | YFRORMMTCSQAHV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-isocyanato-1,3-dihydrobenzimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-isocyanato-1,3-dihydrobenzimidazole-2-thione?
The IUPAC name of 5-isocyanato-1,3-dihydrobenzimidazole-2-thione (CID 169352100) is 5-isocyanato-1,3-dihydrobenzimidazole-2-thione.
What is the SMILES notation for 5-isocyanato-1,3-dihydrobenzimidazole-2-thione?
The canonical SMILES for 5-isocyanato-1,3-dihydrobenzimidazole-2-thione is O=C=Nc1ccc2[nH]c(=S)[nH]c2c1.
What is the InChIKey of 5-isocyanato-1,3-dihydrobenzimidazole-2-thione?
The InChIKey is YFRORMMTCSQAHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3OS/c12-4-9-5-1-2-6-7(3-5)11-8(13)10-6/h1-3H,(H2,10,11,13).
What are the key properties of 5-isocyanato-1,3-dihydrobenzimidazole-2-thione?
5-isocyanato-1,3-dihydrobenzimidazole-2-thione has a molecular weight of 191.22 g/mol, XLogP of 2.19, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-isocyanato-1,3-dihydrobenzimidazole-2-thione is sourced from PubChem (CID 169352100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).