About 2,4-dibromo-1-isocyanato-3,5-dimethylbenzene
2,4-dibromo-1-isocyanato-3,5-dimethylbenzene (PubChem CID 169352483) has the molecular formula C9H7Br2NO
and a molecular weight of 304.97 g/mol. Its IUPAC name is 2,4-dibromo-1-isocyanato-3,5-dimethylbenzene.
Molecular Properties
| Compound Name | 2,4-dibromo-1-isocyanato-3,5-dimethylbenzene |
| PubChem CID | 169352483 |
| Molecular Formula | C9H7Br2NO |
| Molecular Weight | 304.97 g/mol |
| Exact Mass | 302.89 |
| IUPAC Name | 2,4-dibromo-1-isocyanato-3,5-dimethylbenzene |
| SMILES | Cc1cc(N=C=O)c(Br)c(C)c1Br |
| InChI | InChI=1S/C9H7Br2NO/c1-5-3-7(12-4-13)9(11)6(2)8(5)10/h3H,1-2H3 |
| InChIKey | XOOMLGSPDKTYEN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.97 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dibromo-1-isocyanato-3,5-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibromo-1-isocyanato-3,5-dimethylbenzene?
The IUPAC name of 2,4-dibromo-1-isocyanato-3,5-dimethylbenzene (CID 169352483) is 2,4-dibromo-1-isocyanato-3,5-dimethylbenzene.
What is the SMILES notation for 2,4-dibromo-1-isocyanato-3,5-dimethylbenzene?
The canonical SMILES for 2,4-dibromo-1-isocyanato-3,5-dimethylbenzene is Cc1cc(N=C=O)c(Br)c(C)c1Br.
What is the InChIKey of 2,4-dibromo-1-isocyanato-3,5-dimethylbenzene?
The InChIKey is XOOMLGSPDKTYEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7Br2NO/c1-5-3-7(12-4-13)9(11)6(2)8(5)10/h3H,1-2H3.
What are the key properties of 2,4-dibromo-1-isocyanato-3,5-dimethylbenzene?
2,4-dibromo-1-isocyanato-3,5-dimethylbenzene has a molecular weight of 304.97 g/mol, XLogP of 3.80, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromo-1-isocyanato-3,5-dimethylbenzene is sourced from PubChem (CID 169352483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).