C17H12N4O2S — CID 169353770
5-(4-isocyanatophenyl)-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 169353770) has the molecular formula C17H12N4O2S and a molecular weight of 336.38 g/mol. Its IUPAC name is 5-(4-isocyanatophenyl)-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-(4-isocyanatophenyl)-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 169353770 |
| Molecular Formula | C17H12N4O2S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 5-(4-isocyanatophenyl)-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2nnc(-c3ccc(N=C=O)cc3)s2)cc1 |
| InChI | InChI=1S/C17H12N4O2S/c1-11-2-6-14(7-3-11)19-15(23)17-21-20-16(24-17)12-4-8-13(9-5-12)18-10-22/h2-9H,1H3,(H,19,23) |
| InChIKey | XOYIXVDGGXJFTI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|