About pentyl 4-isocyanatobenzoate
pentyl 4-isocyanatobenzoate (PubChem CID 169354455) has the molecular formula C13H15NO3
and a molecular weight of 233.27 g/mol. Its IUPAC name is pentyl 4-isocyanatobenzoate.
Molecular Properties
| Compound Name | pentyl 4-isocyanatobenzoate |
| PubChem CID | 169354455 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | pentyl 4-isocyanatobenzoate |
| SMILES | CCCCCOC(=O)c1ccc(N=C=O)cc1 |
| InChI | InChI=1S/C13H15NO3/c1-2-3-4-9-17-13(16)11-5-7-12(8-6-11)14-10-15/h5-8H,2-4,9H2,1H3 |
| InChIKey | CCXOCKGEALMENN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze pentyl 4-isocyanatobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentyl 4-isocyanatobenzoate?
The IUPAC name of pentyl 4-isocyanatobenzoate (CID 169354455) is pentyl 4-isocyanatobenzoate.
What is the SMILES notation for pentyl 4-isocyanatobenzoate?
The canonical SMILES for pentyl 4-isocyanatobenzoate is CCCCCOC(=O)c1ccc(N=C=O)cc1.
What is the InChIKey of pentyl 4-isocyanatobenzoate?
The InChIKey is CCXOCKGEALMENN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3/c1-2-3-4-9-17-13(16)11-5-7-12(8-6-11)14-10-15/h5-8H,2-4,9H2,1H3.
What are the key properties of pentyl 4-isocyanatobenzoate?
pentyl 4-isocyanatobenzoate has a molecular weight of 233.27 g/mol, XLogP of 3.00, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pentyl 4-isocyanatobenzoate is sourced from PubChem (CID 169354455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).