About 2-(3-isocyanatophenyl)-5,5-dimethyl-1,3-dioxane
2-(3-isocyanatophenyl)-5,5-dimethyl-1,3-dioxane (PubChem CID 169355560) has the molecular formula C13H15NO3
and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-(3-isocyanatophenyl)-5,5-dimethyl-1,3-dioxane.
Molecular Properties
| Compound Name | 2-(3-isocyanatophenyl)-5,5-dimethyl-1,3-dioxane |
| PubChem CID | 169355560 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 2-(3-isocyanatophenyl)-5,5-dimethyl-1,3-dioxane |
| SMILES | CC1(C)COC(c2cccc(N=C=O)c2)OC1 |
| InChI | InChI=1S/C13H15NO3/c1-13(2)7-16-12(17-8-13)10-4-3-5-11(6-10)14-9-15/h3-6,12H,7-8H2,1-2H3 |
| InChIKey | CNTSADAIBIDUCA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-isocyanatophenyl)-5,5-dimethyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-isocyanatophenyl)-5,5-dimethyl-1,3-dioxane?
The IUPAC name of 2-(3-isocyanatophenyl)-5,5-dimethyl-1,3-dioxane (CID 169355560) is 2-(3-isocyanatophenyl)-5,5-dimethyl-1,3-dioxane.
What is the SMILES notation for 2-(3-isocyanatophenyl)-5,5-dimethyl-1,3-dioxane?
The canonical SMILES for 2-(3-isocyanatophenyl)-5,5-dimethyl-1,3-dioxane is CC1(C)COC(c2cccc(N=C=O)c2)OC1.
What is the InChIKey of 2-(3-isocyanatophenyl)-5,5-dimethyl-1,3-dioxane?
The InChIKey is CNTSADAIBIDUCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3/c1-13(2)7-16-12(17-8-13)10-4-3-5-11(6-10)14-9-15/h3-6,12H,7-8H2,1-2H3.
What are the key properties of 2-(3-isocyanatophenyl)-5,5-dimethyl-1,3-dioxane?
2-(3-isocyanatophenyl)-5,5-dimethyl-1,3-dioxane has a molecular weight of 233.27 g/mol, XLogP of 2.73, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-isocyanatophenyl)-5,5-dimethyl-1,3-dioxane is sourced from PubChem (CID 169355560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).