C11H13N3O3S — CID 169356062
3-[[4-(carbamothioylamino)benzoyl]amino]propanoic acid (PubChem CID 169356062) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is 3-[[4-(carbamothioylamino)benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-(carbamothioylamino)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 169356062 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 3-[[4-(carbamothioylamino)benzoyl]amino]propanoic acid |
| SMILES | NC(=S)Nc1ccc(C(=O)NCCC(=O)O)cc1 |
| InChI | InChI=1S/C11H13N3O3S/c12-11(18)14-8-3-1-7(2-4-8)10(17)13-6-5-9(15)16/h1-4H,5-6H2,(H,13,17)(H,15,16)(H3,12,14,18) |
| InChIKey | KXXWLJAIFJQMRO-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|