C10H14N4S — CID 169358275
2,3,4,5-tetrahydro-1H-1,4-benzodiazepin-7-ylthiourea (PubChem CID 169358275) has the molecular formula C10H14N4S and a molecular weight of 222.32 g/mol. Its IUPAC name is 2,3,4,5-tetrahydro-1H-1,4-benzodiazepin-7-ylthiourea.
| Compound Name | 2,3,4,5-tetrahydro-1H-1,4-benzodiazepin-7-ylthiourea |
|---|---|
| PubChem CID | 169358275 |
| Molecular Formula | C10H14N4S |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 2,3,4,5-tetrahydro-1H-1,4-benzodiazepin-7-ylthiourea |
| SMILES | NC(=S)Nc1ccc2c(c1)CNCCN2 |
| InChI | InChI=1S/C10H14N4S/c11-10(15)14-8-1-2-9-7(5-8)6-12-3-4-13-9/h1-2,5,12-13H,3-4,6H2,(H3,11,14,15) |
| InChIKey | RWUKKXWJSMOJFX-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|