C12H17N3O3S2 — CID 169358512
(4-methyl-3-morpholin-4-ylsulfonylphenyl)thiourea (PubChem CID 169358512) has the molecular formula C12H17N3O3S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is (4-methyl-3-morpholin-4-ylsulfonylphenyl)thiourea.
| Compound Name | (4-methyl-3-morpholin-4-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 169358512 |
| Molecular Formula | C12H17N3O3S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | (4-methyl-3-morpholin-4-ylsulfonylphenyl)thiourea |
| SMILES | Cc1ccc(NC(N)=S)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C12H17N3O3S2/c1-9-2-3-10(14-12(13)19)8-11(9)20(16,17)15-4-6-18-7-5-15/h2-3,8H,4-7H2,1H3,(H3,13,14,19) |
| InChIKey | PRVCOIZHOIZLPM-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|