C13H17N3O2S — CID 169359260
[1-(2-methoxyacetyl)-3,4-dihydro-2H-quinolin-7-yl]thiourea (PubChem CID 169359260) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is [1-(2-methoxyacetyl)-3,4-dihydro-2H-quinolin-7-yl]thiourea.
| Compound Name | [1-(2-methoxyacetyl)-3,4-dihydro-2H-quinolin-7-yl]thiourea |
|---|---|
| PubChem CID | 169359260 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | [1-(2-methoxyacetyl)-3,4-dihydro-2H-quinolin-7-yl]thiourea |
| SMILES | COCC(=O)N1CCCc2ccc(NC(N)=S)cc21 |
| InChI | InChI=1S/C13H17N3O2S/c1-18-8-12(17)16-6-2-3-9-4-5-10(7-11(9)16)15-13(14)19/h4-5,7H,2-3,6,8H2,1H3,(H3,14,15,19) |
| InChIKey | MXEIISZQCRICSK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|