C13H14N4S — CID 169359415
[4-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)phenyl]thiourea (PubChem CID 169359415) has the molecular formula C13H14N4S and a molecular weight of 258.35 g/mol. Its IUPAC name is [4-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)phenyl]thiourea.
| Compound Name | [4-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 169359415 |
| Molecular Formula | C13H14N4S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | [4-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)phenyl]thiourea |
| SMILES | NC(=S)Nc1ccc(-c2n[nH]c3c2CCC3)cc1 |
| InChI | InChI=1S/C13H14N4S/c14-13(18)15-9-6-4-8(5-7-9)12-10-2-1-3-11(10)16-17-12/h4-7H,1-3H2,(H,16,17)(H3,14,15,18) |
| InChIKey | CDWZXMCKXUWQDY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|