About (1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)thiourea
(1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)thiourea (PubChem CID 169359553) has the molecular formula C13H17N3OS
and a molecular weight of 263.37 g/mol. Its IUPAC name is (1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)thiourea.
Molecular Properties
| Compound Name | (1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)thiourea |
| PubChem CID | 169359553 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | (1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)thiourea |
| SMILES | CCN1C(=O)C(C)(C)c2cc(NC(N)=S)ccc21 |
| InChI | InChI=1S/C13H17N3OS/c1-4-16-10-6-5-8(15-12(14)18)7-9(10)13(2,3)11(16)17/h5-7H,4H2,1-3H3,(H3,14,15,18) |
| InChIKey | XIWPKPONVLDDNY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)thiourea?
The IUPAC name of (1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)thiourea (CID 169359553) is (1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)thiourea.
What is the SMILES notation for (1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)thiourea?
The canonical SMILES for (1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)thiourea is CCN1C(=O)C(C)(C)c2cc(NC(N)=S)ccc21.
What is the InChIKey of (1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)thiourea?
The InChIKey is XIWPKPONVLDDNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3OS/c1-4-16-10-6-5-8(15-12(14)18)7-9(10)13(2,3)11(16)17/h5-7H,4H2,1-3H3,(H3,14,15,18).
What are the key properties of (1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)thiourea?
(1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)thiourea has a molecular weight of 263.37 g/mol, XLogP of 1.99, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethyl-3,3-dimethyl-2-oxoindol-5-yl)thiourea is sourced from PubChem (CID 169359553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).